About ethyl (E)-2,2-difluoro-4-(6-methoxynaphthalen-2-yl)-4-(trifluoromethylsulfanyl)but-3-enoate
ethyl (E)-2,2-difluoro-4-(6-methoxynaphthalen-2-yl)-4-(trifluoromethylsulfanyl)but-3-enoate (PubChem CID 162411443) has the molecular formula C18H15F5O3S
and a molecular weight of 406.37 g/mol. Its IUPAC name is ethyl (E)-2,2-difluoro-4-(6-methoxynaphthalen-2-yl)-4-(trifluoromethylsulfanyl)but-3-enoate.
Molecular Properties
| Compound Name | ethyl (E)-2,2-difluoro-4-(6-methoxynaphthalen-2-yl)-4-(trifluoromethylsulfanyl)but-3-enoate |
| PubChem CID | 162411443 |
| Molecular Formula | C18H15F5O3S |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | ethyl (E)-2,2-difluoro-4-(6-methoxynaphthalen-2-yl)-4-(trifluoromethylsulfanyl)but-3-enoate |
| SMILES | CCOC(=O)C(F)(F)/C=C(/SC(F)(F)F)c1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C18H15F5O3S/c1-3-26-16(24)17(19,20)10-15(27-18(21,22)23)13-5-4-12-9-14(25-2)7-6-11(12)8-13/h4-10H,3H2,1-2H3/b15-10+ |
| InChIKey | PRIQYGJQCKWARW-XNTDXEJSSA-N |
| XLogP | 5.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (E)-2,2-difluoro-4-(6-methoxynaphthalen-2-yl)-4-(trifluoromethylsulfanyl)but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-2,2-difluoro-4-(6-methoxynaphthalen-2-yl)-4-(trifluoromethylsulfanyl)but-3-enoate?
The IUPAC name of ethyl (E)-2,2-difluoro-4-(6-methoxynaphthalen-2-yl)-4-(trifluoromethylsulfanyl)but-3-enoate (CID 162411443) is ethyl (E)-2,2-difluoro-4-(6-methoxynaphthalen-2-yl)-4-(trifluoromethylsulfanyl)but-3-enoate.
What is the SMILES notation for ethyl (E)-2,2-difluoro-4-(6-methoxynaphthalen-2-yl)-4-(trifluoromethylsulfanyl)but-3-enoate?
The canonical SMILES for ethyl (E)-2,2-difluoro-4-(6-methoxynaphthalen-2-yl)-4-(trifluoromethylsulfanyl)but-3-enoate is CCOC(=O)C(F)(F)/C=C(/SC(F)(F)F)c1ccc2cc(OC)ccc2c1.
What is the InChIKey of ethyl (E)-2,2-difluoro-4-(6-methoxynaphthalen-2-yl)-4-(trifluoromethylsulfanyl)but-3-enoate?
The InChIKey is PRIQYGJQCKWARW-XNTDXEJSSA-N. The full InChI is InChI=1S/C18H15F5O3S/c1-3-26-16(24)17(19,20)10-15(27-18(21,22)23)13-5-4-12-9-14(25-2)7-6-11(12)8-13/h4-10H,3H2,1-2H3/b15-10+.
What are the key properties of ethyl (E)-2,2-difluoro-4-(6-methoxynaphthalen-2-yl)-4-(trifluoromethylsulfanyl)but-3-enoate?
ethyl (E)-2,2-difluoro-4-(6-methoxynaphthalen-2-yl)-4-(trifluoromethylsulfanyl)but-3-enoate has a molecular weight of 406.37 g/mol, XLogP of 5.64, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-2,2-difluoro-4-(6-methoxynaphthalen-2-yl)-4-(trifluoromethylsulfanyl)but-3-enoate is sourced from PubChem (CID 162411443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).