About 2-pyridin-2-yl-3,4-dihydroisoquinolin-1-one
2-pyridin-2-yl-3,4-dihydroisoquinolin-1-one (PubChem CID 162411667) has the molecular formula C14H12N2O
and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-pyridin-2-yl-3,4-dihydroisoquinolin-1-one.
Molecular Properties
| Compound Name | 2-pyridin-2-yl-3,4-dihydroisoquinolin-1-one |
| PubChem CID | 162411667 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 2-pyridin-2-yl-3,4-dihydroisoquinolin-1-one |
| SMILES | O=C1c2ccccc2CCN1c1ccccn1 |
| InChI | InChI=1S/C14H12N2O/c17-14-12-6-2-1-5-11(12)8-10-16(14)13-7-3-4-9-15-13/h1-7,9H,8,10H2 |
| InChIKey | AZXUGPFLZWWHJZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-pyridin-2-yl-3,4-dihydroisoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-yl-3,4-dihydroisoquinolin-1-one?
The IUPAC name of 2-pyridin-2-yl-3,4-dihydroisoquinolin-1-one (CID 162411667) is 2-pyridin-2-yl-3,4-dihydroisoquinolin-1-one.
What is the SMILES notation for 2-pyridin-2-yl-3,4-dihydroisoquinolin-1-one?
The canonical SMILES for 2-pyridin-2-yl-3,4-dihydroisoquinolin-1-one is O=C1c2ccccc2CCN1c1ccccn1.
What is the InChIKey of 2-pyridin-2-yl-3,4-dihydroisoquinolin-1-one?
The InChIKey is AZXUGPFLZWWHJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O/c17-14-12-6-2-1-5-11(12)8-10-16(14)13-7-3-4-9-15-13/h1-7,9H,8,10H2.
What are the key properties of 2-pyridin-2-yl-3,4-dihydroisoquinolin-1-one?
2-pyridin-2-yl-3,4-dihydroisoquinolin-1-one has a molecular weight of 224.26 g/mol, XLogP of 2.28, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-yl-3,4-dihydroisoquinolin-1-one is sourced from PubChem (CID 162411667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).