C23H40O7 — CID 162411987
(1R,3aR,6aS)-1-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propyl]-5',5'-dimethylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one (PubChem CID 162411987) has the molecular formula C23H40O7 and a molecular weight of 428.57 g/mol. Its IUPAC name is (1R,3aR,6aS)-1-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propyl]-5',5'-dimethylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one.
| Compound Name | (1R,3aR,6aS)-1-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propyl]-5',5'-dimethylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one |
|---|---|
| PubChem CID | 162411987 |
| Molecular Formula | C23H40O7 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | (1R,3aR,6aS)-1-[3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propyl]-5',5'-dimethylspiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one |
| SMILES | COCCOCCOCCOCCC[C@H]1C(=O)C[C@@H]2CC3(C[C@@H]21)OCC(C)(C)CO3 |
| InChI | InChI=1S/C23H40O7/c1-22(2)16-29-23(30-17-22)14-18-13-21(24)19(20(18)15-23)5-4-6-26-9-10-28-12-11-27-8-7-25-3/h18-20H,4-17H2,1-3H3/t18-,19-,20+/m1/s1 |
| InChIKey | UGGMKFCUBSNQFD-AQNXPRMDSA-N |
| XLogP | 2.85 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|