C11H8BNO2 — CID 162412034
2-phenyl-[1,3,2]dioxaborolo[4,5-b]pyridine (PubChem CID 162412034) has the molecular formula C11H8BNO2 and a molecular weight of 197.00 g/mol. Its IUPAC name is 2-phenyl-[1,3,2]dioxaborolo[4,5-b]pyridine.
| Compound Name | 2-phenyl-[1,3,2]dioxaborolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 162412034 |
| Molecular Formula | C11H8BNO2 |
| Molecular Weight | 197.00 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 2-phenyl-[1,3,2]dioxaborolo[4,5-b]pyridine |
| SMILES | c1ccc(B2Oc3cccnc3O2)cc1 |
| InChI | InChI=1S/C11H8BNO2/c1-2-5-9(6-3-1)12-14-10-7-4-8-13-11(10)15-12/h1-8H |
| InChIKey | VUIDSPXLHMFTPW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.00 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|