C22H26O5S — CID 162412059
(2R,3S,4R,4aR,8aR)-2-(hydroxymethyl)-3-phenylmethoxy-7-phenylsulfanyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-4-ol (PubChem CID 162412059) has the molecular formula C22H26O5S and a molecular weight of 402.51 g/mol. Its IUPAC name is (2R,3S,4R,4aR,8aR)-2-(hydroxymethyl)-3-phenylmethoxy-7-phenylsulfanyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-4-ol.
| Compound Name | (2R,3S,4R,4aR,8aR)-2-(hydroxymethyl)-3-phenylmethoxy-7-phenylsulfanyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-4-ol |
|---|---|
| PubChem CID | 162412059 |
| Molecular Formula | C22H26O5S |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (2R,3S,4R,4aR,8aR)-2-(hydroxymethyl)-3-phenylmethoxy-7-phenylsulfanyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-4-ol |
| SMILES | OC[C@H]1O[C@@H]2CC(Sc3ccccc3)CO[C@@H]2[C@@H](O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H26O5S/c23-12-19-22(25-13-15-7-3-1-4-8-15)20(24)21-18(27-19)11-17(14-26-21)28-16-9-5-2-6-10-16/h1-10,17-24H,11-14H2/t17?,18-,19-,20-,21+,22-/m1/s1 |
| InChIKey | QVZNJPLIEULCAG-MINVAQPASA-N |
| XLogP | 2.64 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |