About 4-[fluoromethylsulfonyl(phenyl)methyl]-1,2-dimethylbenzene
4-[fluoromethylsulfonyl(phenyl)methyl]-1,2-dimethylbenzene (PubChem CID 162412077) has the molecular formula C16H17FO2S
and a molecular weight of 292.38 g/mol. Its IUPAC name is 4-[fluoromethylsulfonyl(phenyl)methyl]-1,2-dimethylbenzene.
Molecular Properties
| Compound Name | 4-[fluoromethylsulfonyl(phenyl)methyl]-1,2-dimethylbenzene |
| PubChem CID | 162412077 |
| Molecular Formula | C16H17FO2S |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 4-[fluoromethylsulfonyl(phenyl)methyl]-1,2-dimethylbenzene |
| SMILES | Cc1ccc(C(c2ccccc2)S(=O)(=O)CF)cc1C |
| InChI | InChI=1S/C16H17FO2S/c1-12-8-9-15(10-13(12)2)16(20(18,19)11-17)14-6-4-3-5-7-14/h3-10,16H,11H2,1-2H3 |
| InChIKey | HXMBKZTYZHKPLG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[fluoromethylsulfonyl(phenyl)methyl]-1,2-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[fluoromethylsulfonyl(phenyl)methyl]-1,2-dimethylbenzene?
The IUPAC name of 4-[fluoromethylsulfonyl(phenyl)methyl]-1,2-dimethylbenzene (CID 162412077) is 4-[fluoromethylsulfonyl(phenyl)methyl]-1,2-dimethylbenzene.
What is the SMILES notation for 4-[fluoromethylsulfonyl(phenyl)methyl]-1,2-dimethylbenzene?
The canonical SMILES for 4-[fluoromethylsulfonyl(phenyl)methyl]-1,2-dimethylbenzene is Cc1ccc(C(c2ccccc2)S(=O)(=O)CF)cc1C.
What is the InChIKey of 4-[fluoromethylsulfonyl(phenyl)methyl]-1,2-dimethylbenzene?
The InChIKey is HXMBKZTYZHKPLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FO2S/c1-12-8-9-15(10-13(12)2)16(20(18,19)11-17)14-6-4-3-5-7-14/h3-10,16H,11H2,1-2H3.
What are the key properties of 4-[fluoromethylsulfonyl(phenyl)methyl]-1,2-dimethylbenzene?
4-[fluoromethylsulfonyl(phenyl)methyl]-1,2-dimethylbenzene has a molecular weight of 292.38 g/mol, XLogP of 3.73, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[fluoromethylsulfonyl(phenyl)methyl]-1,2-dimethylbenzene is sourced from PubChem (CID 162412077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).