C17H28O2 — CID 162412095
3-[(5R,7aS)-4-butyl-7a-methyl-1,2,3,5,6,7-hexahydroinden-5-yl]propanoic acid (PubChem CID 162412095) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 3-[(5R,7aS)-4-butyl-7a-methyl-1,2,3,5,6,7-hexahydroinden-5-yl]propanoic acid.
| Compound Name | 3-[(5R,7aS)-4-butyl-7a-methyl-1,2,3,5,6,7-hexahydroinden-5-yl]propanoic acid |
|---|---|
| PubChem CID | 162412095 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 3-[(5R,7aS)-4-butyl-7a-methyl-1,2,3,5,6,7-hexahydroinden-5-yl]propanoic acid |
| SMILES | CCCCC1=C2CCC[C@@]2(C)CC[C@@H]1CCC(=O)O |
| InChI | InChI=1S/C17H28O2/c1-3-4-6-14-13(8-9-16(18)19)10-12-17(2)11-5-7-15(14)17/h13H,3-12H2,1-2H3,(H,18,19)/t13-,17-/m0/s1 |
| InChIKey | KJVRLGCIDUACTA-GUYCJALGSA-N |
| XLogP | 4.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|