C9H13Y2- — CID 162412287
(3aR,6aS)-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ide;bis(yttrium) (PubChem CID 162412287) has the molecular formula C9H13Y2- and a molecular weight of 299.02 g/mol. Its IUPAC name is (3aR,6aS)-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ide;bis(yttrium).
| Compound Name | (3aR,6aS)-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ide;bis(yttrium) |
|---|---|
| PubChem CID | 162412287 |
| Molecular Formula | C9H13Y2- |
| Molecular Weight | 299.02 g/mol |
| Exact Mass | 298.91 |
| IUPAC Name | (3aR,6aS)-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ide;bis(yttrium) |
| SMILES | C=C1C[C@H]2C[CH-]C[C@H]2C1.[Y].[Y] |
| InChI | InChI=1S/C9H13.2Y/c1-7-5-8-3-2-4-9(8)6-7;;/h2,8-9H,1,3-6H2;;/q-1;;/t8-,9+;; |
| InChIKey | FBNYELJGKZQUEI-DRJPZDRJSA-N |
| XLogP | 2.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.02 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|