C21H23NO6S — CID 162412362
methyl N-[(6S,8aS)-8-hydroxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate (PubChem CID 162412362) has the molecular formula C21H23NO6S and a molecular weight of 417.48 g/mol. Its IUPAC name is methyl N-[(6S,8aS)-8-hydroxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate.
| Compound Name | methyl N-[(6S,8aS)-8-hydroxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
|---|---|
| PubChem CID | 162412362 |
| Molecular Formula | C21H23NO6S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | methyl N-[(6S,8aS)-8-hydroxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
| SMILES | COC(=O)NC1C(O)[C@@H]2OC(c3ccccc3)OCC2O[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C21H23NO6S/c1-25-21(24)22-16-17(23)18-15(27-20(16)29-14-10-6-3-7-11-14)12-26-19(28-18)13-8-4-2-5-9-13/h2-11,15-20,23H,12H2,1H3,(H,22,24)/t15?,16?,17?,18-,19?,20+/m1/s1 |
| InChIKey | BLXMDRQTOOXHLK-JKHWQFEASA-N |
| XLogP | 2.70 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |