C14H16O4 — CID 162412472
(3'aR,4'aS,8'aR,8'bR)-spiro[1,3-dioxolane-2,1'-3,3a,4a,8,8a,8b-hexahydro-2H-cyclopenta[b]indene]-4',7'-dione (PubChem CID 162412472) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is (3'aR,4'aS,8'aR,8'bR)-spiro[1,3-dioxolane-2,1'-3,3a,4a,8,8a,8b-hexahydro-2H-cyclopenta[b]indene]-4',7'-dione.
| Compound Name | (3'aR,4'aS,8'aR,8'bR)-spiro[1,3-dioxolane-2,1'-3,3a,4a,8,8a,8b-hexahydro-2H-cyclopenta[b]indene]-4',7'-dione |
|---|---|
| PubChem CID | 162412472 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (3'aR,4'aS,8'aR,8'bR)-spiro[1,3-dioxolane-2,1'-3,3a,4a,8,8a,8b-hexahydro-2H-cyclopenta[b]indene]-4',7'-dione |
| SMILES | O=C1C=C[C@@H]2C(=O)[C@@H]3CCC4(OCCO4)[C@@H]3[C@@H]2C1 |
| InChI | InChI=1S/C14H16O4/c15-8-1-2-9-11(7-8)12-10(13(9)16)3-4-14(12)17-5-6-18-14/h1-2,9-12H,3-7H2/t9-,10+,11+,12-/m0/s1 |
| InChIKey | XUXFJQCAJJTYPA-QCNOEVLYSA-N |
| XLogP | 1.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |