C15H17BrINO3 — CID 162412544
tert-butyl (3aS,8bR)-7-bromo-8b-iodo-2,3a-dihydro-1H-furo[2,3-b]indole-4-carboxylate (PubChem CID 162412544) has the molecular formula C15H17BrINO3 and a molecular weight of 466.11 g/mol. Its IUPAC name is tert-butyl (3aS,8bR)-7-bromo-8b-iodo-2,3a-dihydro-1H-furo[2,3-b]indole-4-carboxylate.
| Compound Name | tert-butyl (3aS,8bR)-7-bromo-8b-iodo-2,3a-dihydro-1H-furo[2,3-b]indole-4-carboxylate |
|---|---|
| PubChem CID | 162412544 |
| Molecular Formula | C15H17BrINO3 |
| Molecular Weight | 466.11 g/mol |
| Exact Mass | 464.94 |
| IUPAC Name | tert-butyl (3aS,8bR)-7-bromo-8b-iodo-2,3a-dihydro-1H-furo[2,3-b]indole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1c2ccc(Br)cc2[C@]2(I)CCO[C@H]12 |
| InChI | InChI=1S/C15H17BrINO3/c1-14(2,3)21-13(19)18-11-5-4-9(16)8-10(11)15(17)6-7-20-12(15)18/h4-5,8,12H,6-7H2,1-3H3/t12-,15+/m0/s1 |
| InChIKey | AGAZIWVUNNLWLO-SWLSCSKDSA-N |
| XLogP | 4.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.11 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|