C19H30O3 — CID 162412578
(3aR,6R)-7-butyl-6-[2-(1,3-dioxolan-2-yl)ethyl]-3a-methyl-3,4,5,6-tetrahydro-1H-inden-2-one (PubChem CID 162412578) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is (3aR,6R)-7-butyl-6-[2-(1,3-dioxolan-2-yl)ethyl]-3a-methyl-3,4,5,6-tetrahydro-1H-inden-2-one.
| Compound Name | (3aR,6R)-7-butyl-6-[2-(1,3-dioxolan-2-yl)ethyl]-3a-methyl-3,4,5,6-tetrahydro-1H-inden-2-one |
|---|---|
| PubChem CID | 162412578 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (3aR,6R)-7-butyl-6-[2-(1,3-dioxolan-2-yl)ethyl]-3a-methyl-3,4,5,6-tetrahydro-1H-inden-2-one |
| SMILES | CCCCC1=C2CC(=O)C[C@@]2(C)CC[C@@H]1CCC1OCCO1 |
| InChI | InChI=1S/C19H30O3/c1-3-4-5-16-14(6-7-18-21-10-11-22-18)8-9-19(2)13-15(20)12-17(16)19/h14,18H,3-13H2,1-2H3/t14-,19+/m0/s1 |
| InChIKey | SRMDKXYZEJZPMS-IFXJQAMLSA-N |
| XLogP | 4.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|