About 4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1-(4-methylphenyl)sulfonylpyrrole-3-carbonitrile
4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1-(4-methylphenyl)sulfonylpyrrole-3-carbonitrile (PubChem CID 162412612) has the molecular formula C19H12F2N2O4S
and a molecular weight of 402.38 g/mol. Its IUPAC name is 4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1-(4-methylphenyl)sulfonylpyrrole-3-carbonitrile.
Molecular Properties
| Compound Name | 4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1-(4-methylphenyl)sulfonylpyrrole-3-carbonitrile |
| PubChem CID | 162412612 |
| Molecular Formula | C19H12F2N2O4S |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1-(4-methylphenyl)sulfonylpyrrole-3-carbonitrile |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(C#N)c(-c3cccc4c3OC(F)(F)O4)c2)cc1 |
| InChI | InChI=1S/C19H12F2N2O4S/c1-12-5-7-14(8-6-12)28(24,25)23-10-13(9-22)16(11-23)15-3-2-4-17-18(15)27-19(20,21)26-17/h2-8,10-11H,1H3 |
| InChIKey | SDRIJHMRIVMIJW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 81.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1-(4-methylphenyl)sulfonylpyrrole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1-(4-methylphenyl)sulfonylpyrrole-3-carbonitrile?
The IUPAC name of 4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1-(4-methylphenyl)sulfonylpyrrole-3-carbonitrile (CID 162412612) is 4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1-(4-methylphenyl)sulfonylpyrrole-3-carbonitrile.
What is the SMILES notation for 4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1-(4-methylphenyl)sulfonylpyrrole-3-carbonitrile?
The canonical SMILES for 4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1-(4-methylphenyl)sulfonylpyrrole-3-carbonitrile is Cc1ccc(S(=O)(=O)n2cc(C#N)c(-c3cccc4c3OC(F)(F)O4)c2)cc1.
What is the InChIKey of 4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1-(4-methylphenyl)sulfonylpyrrole-3-carbonitrile?
The InChIKey is SDRIJHMRIVMIJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12F2N2O4S/c1-12-5-7-14(8-6-12)28(24,25)23-10-13(9-22)16(11-23)15-3-2-4-17-18(15)27-19(20,21)26-17/h2-8,10-11H,1H3.
What are the key properties of 4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1-(4-methylphenyl)sulfonylpyrrole-3-carbonitrile?
4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1-(4-methylphenyl)sulfonylpyrrole-3-carbonitrile has a molecular weight of 402.38 g/mol, XLogP of 3.89, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1-(4-methylphenyl)sulfonylpyrrole-3-carbonitrile is sourced from PubChem (CID 162412612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).