C10H11BrO3 — CID 162412839
(3'aR,6'aR)-5'-bromospiro[1,3-dioxolane-2,4'-3a,5,6,6a-tetrahydropentalene]-1'-one (PubChem CID 162412839) has the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. Its IUPAC name is (3'aR,6'aR)-5'-bromospiro[1,3-dioxolane-2,4'-3a,5,6,6a-tetrahydropentalene]-1'-one.
| Compound Name | (3'aR,6'aR)-5'-bromospiro[1,3-dioxolane-2,4'-3a,5,6,6a-tetrahydropentalene]-1'-one |
|---|---|
| PubChem CID | 162412839 |
| Molecular Formula | C10H11BrO3 |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | (3'aR,6'aR)-5'-bromospiro[1,3-dioxolane-2,4'-3a,5,6,6a-tetrahydropentalene]-1'-one |
| SMILES | O=C1C=C[C@@H]2[C@H]1CC(Br)C21OCCO1 |
| InChI | InChI=1S/C10H11BrO3/c11-9-5-6-7(1-2-8(6)12)10(9)13-3-4-14-10/h1-2,6-7,9H,3-5H2/t6-,7-,9?/m1/s1 |
| InChIKey | YQFQQWQGWFLASW-UMPGHQJDSA-N |
| XLogP | 1.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|