C14H23BrO4 — CID 162412840
(1'S,3'S,3'aR,6'aR)-5'-bromo-3'-(4-hydroxybutyl)spiro[1,3-dioxolane-2,4'-2,3,3a,5,6,6a-hexahydro-1H-pentalene]-1'-ol (PubChem CID 162412840) has the molecular formula C14H23BrO4 and a molecular weight of 335.24 g/mol. Its IUPAC name is (1'S,3'S,3'aR,6'aR)-5'-bromo-3'-(4-hydroxybutyl)spiro[1,3-dioxolane-2,4'-2,3,3a,5,6,6a-hexahydro-1H-pentalene]-1'-ol.
| Compound Name | (1'S,3'S,3'aR,6'aR)-5'-bromo-3'-(4-hydroxybutyl)spiro[1,3-dioxolane-2,4'-2,3,3a,5,6,6a-hexahydro-1H-pentalene]-1'-ol |
|---|---|
| PubChem CID | 162412840 |
| Molecular Formula | C14H23BrO4 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | (1'S,3'S,3'aR,6'aR)-5'-bromo-3'-(4-hydroxybutyl)spiro[1,3-dioxolane-2,4'-2,3,3a,5,6,6a-hexahydro-1H-pentalene]-1'-ol |
| SMILES | OCCCC[C@H]1C[C@H](O)[C@@H]2CC(Br)C3(OCCO3)[C@H]12 |
| InChI | InChI=1S/C14H23BrO4/c15-12-8-10-11(17)7-9(3-1-2-4-16)13(10)14(12)18-5-6-19-14/h9-13,16-17H,1-8H2/t9-,10-,11-,12?,13+/m0/s1 |
| InChIKey | UHPSTLNCWVYTSK-HOJJEXJGSA-N |
| XLogP | 1.67 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|