About methyl (Z)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]prop-2-enoate
methyl (Z)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]prop-2-enoate (PubChem CID 162412991) has the molecular formula C7H8N2O2S2
and a molecular weight of 216.29 g/mol. Its IUPAC name is methyl (Z)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]prop-2-enoate.
Molecular Properties
| Compound Name | methyl (Z)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]prop-2-enoate |
| PubChem CID | 162412991 |
| Molecular Formula | C7H8N2O2S2 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.00 |
| IUPAC Name | methyl (Z)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]prop-2-enoate |
| SMILES | COC(=O)/C=C\Sc1nnc(C)s1 |
| InChI | InChI=1S/C7H8N2O2S2/c1-5-8-9-7(13-5)12-4-3-6(10)11-2/h3-4H,1-2H3/b4-3- |
| InChIKey | LNVLFGHKWVLWCS-ARJAWSKDSA-N |
| XLogP | 1.63 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (Z)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (Z)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]prop-2-enoate?
The IUPAC name of methyl (Z)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]prop-2-enoate (CID 162412991) is methyl (Z)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]prop-2-enoate.
What is the SMILES notation for methyl (Z)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]prop-2-enoate?
The canonical SMILES for methyl (Z)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]prop-2-enoate is COC(=O)/C=C\Sc1nnc(C)s1.
What is the InChIKey of methyl (Z)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]prop-2-enoate?
The InChIKey is LNVLFGHKWVLWCS-ARJAWSKDSA-N. The full InChI is InChI=1S/C7H8N2O2S2/c1-5-8-9-7(13-5)12-4-3-6(10)11-2/h3-4H,1-2H3/b4-3-.
What are the key properties of methyl (Z)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]prop-2-enoate?
methyl (Z)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]prop-2-enoate has a molecular weight of 216.29 g/mol, XLogP of 1.63, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]prop-2-enoate is sourced from PubChem (CID 162412991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).