About 2,6-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxane
2,6-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxane (PubChem CID 162412998) has the molecular formula C12H24O4
and a molecular weight of 232.32 g/mol. Its IUPAC name is 2,6-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxane.
Molecular Properties
| Compound Name | 2,6-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxane |
| PubChem CID | 162412998 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 2,6-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxane |
| SMILES | CC(C)(C)OC1COCC(OC(C)(C)C)O1 |
| InChI | InChI=1S/C12H24O4/c1-11(2,3)15-9-7-13-8-10(14-9)16-12(4,5)6/h9-10H,7-8H2,1-6H3 |
| InChIKey | OKUNLKQZOJUCPY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,6-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxane?
The IUPAC name of 2,6-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxane (CID 162412998) is 2,6-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxane.
What is the SMILES notation for 2,6-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxane?
The canonical SMILES for 2,6-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxane is CC(C)(C)OC1COCC(OC(C)(C)C)O1.
What is the InChIKey of 2,6-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxane?
The InChIKey is OKUNLKQZOJUCPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O4/c1-11(2,3)15-9-7-13-8-10(14-9)16-12(4,5)6/h9-10H,7-8H2,1-6H3.
What are the key properties of 2,6-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxane?
2,6-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxane has a molecular weight of 232.32 g/mol, XLogP of 2.32, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis[(2-methylpropan-2-yl)oxy]-1,4-dioxane is sourced from PubChem (CID 162412998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).