About 7-methylnon-8-en-2-yl pent-4-enoate
7-methylnon-8-en-2-yl pent-4-enoate (PubChem CID 162413015) has the molecular formula C15H26O2
and a molecular weight of 238.37 g/mol. Its IUPAC name is 7-methylnon-8-en-2-yl pent-4-enoate.
Molecular Properties
| Compound Name | 7-methylnon-8-en-2-yl pent-4-enoate |
| PubChem CID | 162413015 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 7-methylnon-8-en-2-yl pent-4-enoate |
| SMILES | C=CCCC(=O)OC(C)CCCCC(C)C=C |
| InChI | InChI=1S/C15H26O2/c1-5-7-12-15(16)17-14(4)11-9-8-10-13(3)6-2/h5-6,13-14H,1-2,7-12H2,3-4H3 |
| InChIKey | QJBHIFPEYDJFLC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-methylnon-8-en-2-yl pent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylnon-8-en-2-yl pent-4-enoate?
The IUPAC name of 7-methylnon-8-en-2-yl pent-4-enoate (CID 162413015) is 7-methylnon-8-en-2-yl pent-4-enoate.
What is the SMILES notation for 7-methylnon-8-en-2-yl pent-4-enoate?
The canonical SMILES for 7-methylnon-8-en-2-yl pent-4-enoate is C=CCCC(=O)OC(C)CCCCC(C)C=C.
What is the InChIKey of 7-methylnon-8-en-2-yl pent-4-enoate?
The InChIKey is QJBHIFPEYDJFLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O2/c1-5-7-12-15(16)17-14(4)11-9-8-10-13(3)6-2/h5-6,13-14H,1-2,7-12H2,3-4H3.
What are the key properties of 7-methylnon-8-en-2-yl pent-4-enoate?
7-methylnon-8-en-2-yl pent-4-enoate has a molecular weight of 238.37 g/mol, XLogP of 4.27, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylnon-8-en-2-yl pent-4-enoate is sourced from PubChem (CID 162413015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).