About 5-(1-benzofuran-2-yl)-1,3-dibenzylpyrimidine-2,4-dione
5-(1-benzofuran-2-yl)-1,3-dibenzylpyrimidine-2,4-dione (PubChem CID 162413109) has the molecular formula C26H20N2O3
and a molecular weight of 408.46 g/mol. Its IUPAC name is 5-(1-benzofuran-2-yl)-1,3-dibenzylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(1-benzofuran-2-yl)-1,3-dibenzylpyrimidine-2,4-dione |
| PubChem CID | 162413109 |
| Molecular Formula | C26H20N2O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 5-(1-benzofuran-2-yl)-1,3-dibenzylpyrimidine-2,4-dione |
| SMILES | O=c1c(-c2cc3ccccc3o2)cn(Cc2ccccc2)c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C26H20N2O3/c29-25-22(24-15-21-13-7-8-14-23(21)31-24)18-27(16-19-9-3-1-4-10-19)26(30)28(25)17-20-11-5-2-6-12-20/h1-15,18H,16-17H2 |
| InChIKey | MTVJCNDEZATTQV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 57.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(1-benzofuran-2-yl)-1,3-dibenzylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-benzofuran-2-yl)-1,3-dibenzylpyrimidine-2,4-dione?
The IUPAC name of 5-(1-benzofuran-2-yl)-1,3-dibenzylpyrimidine-2,4-dione (CID 162413109) is 5-(1-benzofuran-2-yl)-1,3-dibenzylpyrimidine-2,4-dione.
What is the SMILES notation for 5-(1-benzofuran-2-yl)-1,3-dibenzylpyrimidine-2,4-dione?
The canonical SMILES for 5-(1-benzofuran-2-yl)-1,3-dibenzylpyrimidine-2,4-dione is O=c1c(-c2cc3ccccc3o2)cn(Cc2ccccc2)c(=O)n1Cc1ccccc1.
What is the InChIKey of 5-(1-benzofuran-2-yl)-1,3-dibenzylpyrimidine-2,4-dione?
The InChIKey is MTVJCNDEZATTQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20N2O3/c29-25-22(24-15-21-13-7-8-14-23(21)31-24)18-27(16-19-9-3-1-4-10-19)26(30)28(25)17-20-11-5-2-6-12-20/h1-15,18H,16-17H2.
What are the key properties of 5-(1-benzofuran-2-yl)-1,3-dibenzylpyrimidine-2,4-dione?
5-(1-benzofuran-2-yl)-1,3-dibenzylpyrimidine-2,4-dione has a molecular weight of 408.46 g/mol, XLogP of 4.52, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-benzofuran-2-yl)-1,3-dibenzylpyrimidine-2,4-dione is sourced from PubChem (CID 162413109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).