C28H25NO — CID 162413162
(R)-[(2R,3S)-1-benzyl-2,3-diphenylaziridin-2-yl]-phenylmethanol (PubChem CID 162413162) has the molecular formula C28H25NO and a molecular weight of 391.51 g/mol. Its IUPAC name is (R)-[(2R,3S)-1-benzyl-2,3-diphenylaziridin-2-yl]-phenylmethanol.
| Compound Name | (R)-[(2R,3S)-1-benzyl-2,3-diphenylaziridin-2-yl]-phenylmethanol |
|---|---|
| PubChem CID | 162413162 |
| Molecular Formula | C28H25NO |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | (R)-[(2R,3S)-1-benzyl-2,3-diphenylaziridin-2-yl]-phenylmethanol |
| SMILES | O[C@H](c1ccccc1)[C@@]1(c2ccccc2)[C@H](c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C28H25NO/c30-27(24-17-9-3-10-18-24)28(25-19-11-4-12-20-25)26(23-15-7-2-8-16-23)29(28)21-22-13-5-1-6-14-22/h1-20,26-27,30H,21H2/t26-,27+,28+,29?/m0/s1 |
| InChIKey | YZVBBKFHEMAVJT-JCDLHITASA-N |
| XLogP | 5.87 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|