C12H22O2S — CID 162413317
(2S,5R)-2,3,4,5-tetraethyl-2,5-dihydrothiophene 1,1-dioxide (PubChem CID 162413317) has the molecular formula C12H22O2S and a molecular weight of 230.37 g/mol. Its IUPAC name is (2S,5R)-2,3,4,5-tetraethyl-2,5-dihydrothiophene 1,1-dioxide.
| Compound Name | (2S,5R)-2,3,4,5-tetraethyl-2,5-dihydrothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 162413317 |
| Molecular Formula | C12H22O2S |
| Molecular Weight | 230.37 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (2S,5R)-2,3,4,5-tetraethyl-2,5-dihydrothiophene 1,1-dioxide |
| SMILES | CCC1=C(CC)[C@H](CC)S(=O)(=O)[C@@H]1CC |
| InChI | InChI=1S/C12H22O2S/c1-5-9-10(6-2)12(8-4)15(13,14)11(9)7-3/h11-12H,5-8H2,1-4H3/t11-,12+ |
| InChIKey | RLVRIRDEWXOALE-TXEJJXNPSA-N |
| XLogP | 3.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|