C15H18F2O4S — CID 162413319
2-(4,4-difluorocyclohexyl)sulfonyl-1-(4-methoxyphenyl)ethanone (PubChem CID 162413319) has the molecular formula C15H18F2O4S and a molecular weight of 332.37 g/mol. Its IUPAC name is 2-(4,4-difluorocyclohexyl)sulfonyl-1-(4-methoxyphenyl)ethanone.
| Compound Name | 2-(4,4-difluorocyclohexyl)sulfonyl-1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 162413319 |
| Molecular Formula | C15H18F2O4S |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2-(4,4-difluorocyclohexyl)sulfonyl-1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)CS(=O)(=O)C2CCC(F)(F)CC2)cc1 |
| InChI | InChI=1S/C15H18F2O4S/c1-21-12-4-2-11(3-5-12)14(18)10-22(19,20)13-6-8-15(16,17)9-7-13/h2-5,13H,6-10H2,1H3 |
| InChIKey | QOKGWBAKRQSJQJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |