C8H14O2S — CID 162413489
(2S)-3-ethyl-2,4-dimethyl-2,5-dihydrothiophene 1,1-dioxide (PubChem CID 162413489) has the molecular formula C8H14O2S and a molecular weight of 174.26 g/mol. Its IUPAC name is (2S)-3-ethyl-2,4-dimethyl-2,5-dihydrothiophene 1,1-dioxide.
| Compound Name | (2S)-3-ethyl-2,4-dimethyl-2,5-dihydrothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 162413489 |
| Molecular Formula | C8H14O2S |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | (2S)-3-ethyl-2,4-dimethyl-2,5-dihydrothiophene 1,1-dioxide |
| SMILES | CCC1=C(C)CS(=O)(=O)[C@H]1C |
| InChI | InChI=1S/C8H14O2S/c1-4-8-6(2)5-11(9,10)7(8)3/h7H,4-5H2,1-3H3/t7-/m0/s1 |
| InChIKey | CVQIFTVYYKSQHE-ZETCQYMHSA-N |
| XLogP | 1.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|