C20H32O8 — CID 162413547
tetraethyl (2E)-2-ethylidene-1-methylpentane-1,1,4,4-tetracarboxylate (PubChem CID 162413547) has the molecular formula C20H32O8 and a molecular weight of 400.47 g/mol. Its IUPAC name is tetraethyl (2E)-2-ethylidene-1-methylpentane-1,1,4,4-tetracarboxylate.
| Compound Name | tetraethyl (2E)-2-ethylidene-1-methylpentane-1,1,4,4-tetracarboxylate |
|---|---|
| PubChem CID | 162413547 |
| Molecular Formula | C20H32O8 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | tetraethyl (2E)-2-ethylidene-1-methylpentane-1,1,4,4-tetracarboxylate |
| SMILES | C/C=C(\CC(C)(C(=O)OCC)C(=O)OCC)C(C)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C20H32O8/c1-8-14(20(7,17(23)27-11-4)18(24)28-12-5)13-19(6,15(21)25-9-2)16(22)26-10-3/h8H,9-13H2,1-7H3/b14-8+ |
| InChIKey | FRMUZWVEZGEVFC-RIYZIHGNSA-N |
| XLogP | 2.59 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|