C15H24O2 — CID 162413549
(4S,7E,11E)-4,8,12-trimethyl-1-oxacyclotrideca-7,11-dien-2-one (PubChem CID 162413549) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (4S,7E,11E)-4,8,12-trimethyl-1-oxacyclotrideca-7,11-dien-2-one.
| Compound Name | (4S,7E,11E)-4,8,12-trimethyl-1-oxacyclotrideca-7,11-dien-2-one |
|---|---|
| PubChem CID | 162413549 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (4S,7E,11E)-4,8,12-trimethyl-1-oxacyclotrideca-7,11-dien-2-one |
| SMILES | C/C1=C\CC[C@H](C)CC(=O)OC/C(C)=C/CC1 |
| InChI | InChI=1S/C15H24O2/c1-12-6-4-8-13(2)10-15(16)17-11-14(3)9-5-7-12/h6,9,13H,4-5,7-8,10-11H2,1-3H3/b12-6+,14-9+/t13-/m0/s1 |
| InChIKey | LCLFBNCUDPVILM-GWKMEYDESA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|