C11H14N2O4S — CID 162413574
tert-butyl N-[2-(2-formyl-1,3-thiazol-4-yl)-2-oxoethyl]carbamate (PubChem CID 162413574) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is tert-butyl N-[2-(2-formyl-1,3-thiazol-4-yl)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-formyl-1,3-thiazol-4-yl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 162413574 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | tert-butyl N-[2-(2-formyl-1,3-thiazol-4-yl)-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)c1csc(C=O)n1 |
| InChI | InChI=1S/C11H14N2O4S/c1-11(2,3)17-10(16)12-4-8(15)7-6-18-9(5-14)13-7/h5-6H,4H2,1-3H3,(H,12,16) |
| InChIKey | DLMQHIAQWBDWRP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|