C14H12BrClN2O3S — CID 162413682
(2R,3S)-3-bromo-6-chloro-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrolo[3,2-c]pyridin-2-ol (PubChem CID 162413682) has the molecular formula C14H12BrClN2O3S and a molecular weight of 403.69 g/mol. Its IUPAC name is (2R,3S)-3-bromo-6-chloro-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrolo[3,2-c]pyridin-2-ol.
| Compound Name | (2R,3S)-3-bromo-6-chloro-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrolo[3,2-c]pyridin-2-ol |
|---|---|
| PubChem CID | 162413682 |
| Molecular Formula | C14H12BrClN2O3S |
| Molecular Weight | 403.69 g/mol |
| Exact Mass | 401.94 |
| IUPAC Name | (2R,3S)-3-bromo-6-chloro-1-(4-methylphenyl)sulfonyl-2,3-dihydropyrrolo[3,2-c]pyridin-2-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2c3cc(Cl)ncc3[C@H](Br)[C@H]2O)cc1 |
| InChI | InChI=1S/C14H12BrClN2O3S/c1-8-2-4-9(5-3-8)22(20,21)18-11-6-12(16)17-7-10(11)13(15)14(18)19/h2-7,13-14,19H,1H3/t13-,14+/m0/s1 |
| InChIKey | BVAYKMYSULXEQR-UONOGXRCSA-N |
| XLogP | 3.01 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.69 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|