C15H21F2N3O2S — CID 162413823
(2S,5R)-2-(5-amino-2-fluorophenyl)-5-ethylsulfonyl-2-(fluoromethyl)-5-methyl-3,4-dihydropyridin-6-amine (PubChem CID 162413823) has the molecular formula C15H21F2N3O2S and a molecular weight of 345.42 g/mol. Its IUPAC name is (2S,5R)-2-(5-amino-2-fluorophenyl)-5-ethylsulfonyl-2-(fluoromethyl)-5-methyl-3,4-dihydropyridin-6-amine.
| Compound Name | (2S,5R)-2-(5-amino-2-fluorophenyl)-5-ethylsulfonyl-2-(fluoromethyl)-5-methyl-3,4-dihydropyridin-6-amine |
|---|---|
| PubChem CID | 162413823 |
| Molecular Formula | C15H21F2N3O2S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (2S,5R)-2-(5-amino-2-fluorophenyl)-5-ethylsulfonyl-2-(fluoromethyl)-5-methyl-3,4-dihydropyridin-6-amine |
| SMILES | CCS(=O)(=O)[C@]1(C)CC[C@@](CF)(c2cc(N)ccc2F)N=C1N |
| InChI | InChI=1S/C15H21F2N3O2S/c1-3-23(21,22)14(2)6-7-15(9-16,20-13(14)19)11-8-10(18)4-5-12(11)17/h4-5,8H,3,6-7,9,18H2,1-2H3,(H2,19,20)/t14-,15-/m1/s1 |
| InChIKey | ZUZDGHXKXABVIF-HUUCEWRRSA-N |
| XLogP | 1.92 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|