C11H16O — CID 162413964
(1S,4E)-1-prop-2-ynylcyclooct-4-en-1-ol (PubChem CID 162413964) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is (1S,4E)-1-prop-2-ynylcyclooct-4-en-1-ol.
| Compound Name | (1S,4E)-1-prop-2-ynylcyclooct-4-en-1-ol |
|---|---|
| PubChem CID | 162413964 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (1S,4E)-1-prop-2-ynylcyclooct-4-en-1-ol |
| SMILES | C#CC[C@@]1(O)CC/C=C\CCC1 |
| InChI | InChI=1S/C11H16O/c1-2-8-11(12)9-6-4-3-5-7-10-11/h1,3-4,12H,5-10H2/b4-3-/t11-/m1/s1 |
| InChIKey | ZMXNRQGJMZZVFT-DLRQAJBASA-N |
| XLogP | 2.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|