C25H32BNO4 — CID 162414026
tert-butyl (2R,3R)-3-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carboxylate (PubChem CID 162414026) has the molecular formula C25H32BNO4 and a molecular weight of 421.35 g/mol. Its IUPAC name is tert-butyl (2R,3R)-3-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl (2R,3R)-3-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 162414026 |
| Molecular Formula | C25H32BNO4 |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | tert-butyl (2R,3R)-3-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1c2ccccc2[C@@H](c2ccccc2)[C@H]1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H32BNO4/c1-23(2,3)29-22(28)27-19-16-12-11-15-18(19)20(17-13-9-8-10-14-17)21(27)26-30-24(4,5)25(6,7)31-26/h8-16,20-21H,1-7H3/t20-,21+/m1/s1 |
| InChIKey | BNTNKGLDXBJAFT-RTWAWAEBSA-N |
| XLogP | 5.57 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|