About ethyl 7-acetamido-4,4-dimethyl-2-methylideneheptanoate
ethyl 7-acetamido-4,4-dimethyl-2-methylideneheptanoate (PubChem CID 162414121) has the molecular formula C14H25NO3
and a molecular weight of 255.36 g/mol. Its IUPAC name is ethyl 7-acetamido-4,4-dimethyl-2-methylideneheptanoate.
Molecular Properties
| Compound Name | ethyl 7-acetamido-4,4-dimethyl-2-methylideneheptanoate |
| PubChem CID | 162414121 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | ethyl 7-acetamido-4,4-dimethyl-2-methylideneheptanoate |
| SMILES | C=C(CC(C)(C)CCCNC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C14H25NO3/c1-6-18-13(17)11(2)10-14(4,5)8-7-9-15-12(3)16/h2,6-10H2,1,3-5H3,(H,15,16) |
| InChIKey | UKXLBUGLDAQLKG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 7-acetamido-4,4-dimethyl-2-methylideneheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-acetamido-4,4-dimethyl-2-methylideneheptanoate?
The IUPAC name of ethyl 7-acetamido-4,4-dimethyl-2-methylideneheptanoate (CID 162414121) is ethyl 7-acetamido-4,4-dimethyl-2-methylideneheptanoate.
What is the SMILES notation for ethyl 7-acetamido-4,4-dimethyl-2-methylideneheptanoate?
The canonical SMILES for ethyl 7-acetamido-4,4-dimethyl-2-methylideneheptanoate is C=C(CC(C)(C)CCCNC(C)=O)C(=O)OCC.
What is the InChIKey of ethyl 7-acetamido-4,4-dimethyl-2-methylideneheptanoate?
The InChIKey is UKXLBUGLDAQLKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO3/c1-6-18-13(17)11(2)10-14(4,5)8-7-9-15-12(3)16/h2,6-10H2,1,3-5H3,(H,15,16).
What are the key properties of ethyl 7-acetamido-4,4-dimethyl-2-methylideneheptanoate?
ethyl 7-acetamido-4,4-dimethyl-2-methylideneheptanoate has a molecular weight of 255.36 g/mol, XLogP of 2.44, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-acetamido-4,4-dimethyl-2-methylideneheptanoate is sourced from PubChem (CID 162414121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).