About hept-6-en-2-yl 4-methylpent-4-enoate
hept-6-en-2-yl 4-methylpent-4-enoate (PubChem CID 162414238) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is hept-6-en-2-yl 4-methylpent-4-enoate.
Molecular Properties
| Compound Name | hept-6-en-2-yl 4-methylpent-4-enoate |
| PubChem CID | 162414238 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | hept-6-en-2-yl 4-methylpent-4-enoate |
| SMILES | C=CCCCC(C)OC(=O)CCC(=C)C |
| InChI | InChI=1S/C13H22O2/c1-5-6-7-8-12(4)15-13(14)10-9-11(2)3/h5,12H,1-2,6-10H2,3-4H3 |
| InChIKey | QABDCKGDJYZHOV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hept-6-en-2-yl 4-methylpent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hept-6-en-2-yl 4-methylpent-4-enoate?
The IUPAC name of hept-6-en-2-yl 4-methylpent-4-enoate (CID 162414238) is hept-6-en-2-yl 4-methylpent-4-enoate.
What is the SMILES notation for hept-6-en-2-yl 4-methylpent-4-enoate?
The canonical SMILES for hept-6-en-2-yl 4-methylpent-4-enoate is C=CCCCC(C)OC(=O)CCC(=C)C.
What is the InChIKey of hept-6-en-2-yl 4-methylpent-4-enoate?
The InChIKey is QABDCKGDJYZHOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O2/c1-5-6-7-8-12(4)15-13(14)10-9-11(2)3/h5,12H,1-2,6-10H2,3-4H3.
What are the key properties of hept-6-en-2-yl 4-methylpent-4-enoate?
hept-6-en-2-yl 4-methylpent-4-enoate has a molecular weight of 210.32 g/mol, XLogP of 3.63, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hept-6-en-2-yl 4-methylpent-4-enoate is sourced from PubChem (CID 162414238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).