C26H34O5S — CID 162414309
[(1S,2R,8aR)-2-ethynyl-5',5',8a-trimethylspiro[1,2,3,5,7,8-hexahydronaphthalene-6,2'-1,3-dioxane]-1-yl]methyl 4-methylbenzenesulfonate (PubChem CID 162414309) has the molecular formula C26H34O5S and a molecular weight of 458.62 g/mol. Its IUPAC name is [(1S,2R,8aR)-2-ethynyl-5',5',8a-trimethylspiro[1,2,3,5,7,8-hexahydronaphthalene-6,2'-1,3-dioxane]-1-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1S,2R,8aR)-2-ethynyl-5',5',8a-trimethylspiro[1,2,3,5,7,8-hexahydronaphthalene-6,2'-1,3-dioxane]-1-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 162414309 |
| Molecular Formula | C26H34O5S |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | [(1S,2R,8aR)-2-ethynyl-5',5',8a-trimethylspiro[1,2,3,5,7,8-hexahydronaphthalene-6,2'-1,3-dioxane]-1-yl]methyl 4-methylbenzenesulfonate |
| SMILES | C#C[C@@H]1CC=C2CC3(CC[C@]2(C)[C@H]1COS(=O)(=O)c1ccc(C)cc1)OCC(C)(C)CO3 |
| InChI | InChI=1S/C26H34O5S/c1-6-20-9-10-21-15-26(29-17-24(3,4)18-30-26)14-13-25(21,5)23(20)16-31-32(27,28)22-11-7-19(2)8-12-22/h1,7-8,10-12,20,23H,9,13-18H2,2-5H3/t20-,23+,25+/m1/s1 |
| InChIKey | YQLMRAXZKXRWMG-PBXXJUDPSA-N |
| XLogP | 4.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|