C9H18N+ — CID 162414343
3-ethyl-1,6-dimethyl-2,3,4,5-tetrahydropyridin-1-ium (PubChem CID 162414343) has the molecular formula C9H18N+ and a molecular weight of 140.25 g/mol. Its IUPAC name is 3-ethyl-1,6-dimethyl-2,3,4,5-tetrahydropyridin-1-ium.
| Compound Name | 3-ethyl-1,6-dimethyl-2,3,4,5-tetrahydropyridin-1-ium |
|---|---|
| PubChem CID | 162414343 |
| Molecular Formula | C9H18N+ |
| Molecular Weight | 140.25 g/mol |
| Exact Mass | 140.14 |
| IUPAC Name | 3-ethyl-1,6-dimethyl-2,3,4,5-tetrahydropyridin-1-ium |
| SMILES | CCC1CCC(C)=[N+](C)C1 |
| InChI | InChI=1S/C9H18N/c1-4-9-6-5-8(2)10(3)7-9/h9H,4-7H2,1-3H3/q+1 |
| InChIKey | KXJLDUJSSIDVKH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|