C22H20N2O4 — CID 162414451
ethyl (E)-4-[3-[(Z)-2-hydroxy-2-phenylethenyl]-2-oxoquinoxalin-1-yl]but-2-enoate (PubChem CID 162414451) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is ethyl (E)-4-[3-[(Z)-2-hydroxy-2-phenylethenyl]-2-oxoquinoxalin-1-yl]but-2-enoate.
| Compound Name | ethyl (E)-4-[3-[(Z)-2-hydroxy-2-phenylethenyl]-2-oxoquinoxalin-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 162414451 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | ethyl (E)-4-[3-[(Z)-2-hydroxy-2-phenylethenyl]-2-oxoquinoxalin-1-yl]but-2-enoate |
| SMILES | CCOC(=O)/C=C/Cn1c(=O)c(/C=C(\O)c2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C22H20N2O4/c1-2-28-21(26)13-8-14-24-19-12-7-6-11-17(19)23-18(22(24)27)15-20(25)16-9-4-3-5-10-16/h3-13,15,25H,2,14H2,1H3/b13-8+,20-15- |
| InChIKey | WIBAEAGHGXWHGI-KOAZRBSPSA-N |
| XLogP | 3.57 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|