About 1-cyclohexyl-4,4-dimethylazetidin-2-one
1-cyclohexyl-4,4-dimethylazetidin-2-one (PubChem CID 162414462) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-cyclohexyl-4,4-dimethylazetidin-2-one.
Molecular Properties
| Compound Name | 1-cyclohexyl-4,4-dimethylazetidin-2-one |
| PubChem CID | 162414462 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 1-cyclohexyl-4,4-dimethylazetidin-2-one |
| SMILES | CC1(C)CC(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C11H19NO/c1-11(2)8-10(13)12(11)9-6-4-3-5-7-9/h9H,3-8H2,1-2H3 |
| InChIKey | BSJVICUQTPAGDB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexyl-4,4-dimethylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-4,4-dimethylazetidin-2-one?
The IUPAC name of 1-cyclohexyl-4,4-dimethylazetidin-2-one (CID 162414462) is 1-cyclohexyl-4,4-dimethylazetidin-2-one.
What is the SMILES notation for 1-cyclohexyl-4,4-dimethylazetidin-2-one?
The canonical SMILES for 1-cyclohexyl-4,4-dimethylazetidin-2-one is CC1(C)CC(=O)N1C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-4,4-dimethylazetidin-2-one?
The InChIKey is BSJVICUQTPAGDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-11(2)8-10(13)12(11)9-6-4-3-5-7-9/h9H,3-8H2,1-2H3.
What are the key properties of 1-cyclohexyl-4,4-dimethylazetidin-2-one?
1-cyclohexyl-4,4-dimethylazetidin-2-one has a molecular weight of 181.28 g/mol, XLogP of 2.33, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-4,4-dimethylazetidin-2-one is sourced from PubChem (CID 162414462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).