About 3,4-dipropyl-2,6-bis(trifluoromethyl)quinoline
3,4-dipropyl-2,6-bis(trifluoromethyl)quinoline (PubChem CID 162414555) has the molecular formula C17H17F6N
and a molecular weight of 349.32 g/mol. Its IUPAC name is 3,4-dipropyl-2,6-bis(trifluoromethyl)quinoline.
Molecular Properties
| Compound Name | 3,4-dipropyl-2,6-bis(trifluoromethyl)quinoline |
| PubChem CID | 162414555 |
| Molecular Formula | C17H17F6N |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 3,4-dipropyl-2,6-bis(trifluoromethyl)quinoline |
| SMILES | CCCc1c(C(F)(F)F)nc2ccc(C(F)(F)F)cc2c1CCC |
| InChI | InChI=1S/C17H17F6N/c1-3-5-11-12(6-4-2)15(17(21,22)23)24-14-8-7-10(9-13(11)14)16(18,19)20/h7-9H,3-6H2,1-2H3 |
| InChIKey | LGXJPSHXZZWAIM-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dipropyl-2,6-bis(trifluoromethyl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dipropyl-2,6-bis(trifluoromethyl)quinoline?
The IUPAC name of 3,4-dipropyl-2,6-bis(trifluoromethyl)quinoline (CID 162414555) is 3,4-dipropyl-2,6-bis(trifluoromethyl)quinoline.
What is the SMILES notation for 3,4-dipropyl-2,6-bis(trifluoromethyl)quinoline?
The canonical SMILES for 3,4-dipropyl-2,6-bis(trifluoromethyl)quinoline is CCCc1c(C(F)(F)F)nc2ccc(C(F)(F)F)cc2c1CCC.
What is the InChIKey of 3,4-dipropyl-2,6-bis(trifluoromethyl)quinoline?
The InChIKey is LGXJPSHXZZWAIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F6N/c1-3-5-11-12(6-4-2)15(17(21,22)23)24-14-8-7-10(9-13(11)14)16(18,19)20/h7-9H,3-6H2,1-2H3.
What are the key properties of 3,4-dipropyl-2,6-bis(trifluoromethyl)quinoline?
3,4-dipropyl-2,6-bis(trifluoromethyl)quinoline has a molecular weight of 349.32 g/mol, XLogP of 6.18, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dipropyl-2,6-bis(trifluoromethyl)quinoline is sourced from PubChem (CID 162414555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).