C24H52O4Si3 — CID 162414638
[(3S,4R)-3,4-bis(triethylsilyloxy)-3,4-dihydro-2H-pyran-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 162414638) has the molecular formula C24H52O4Si3 and a molecular weight of 488.93 g/mol. Its IUPAC name is [(3S,4R)-3,4-bis(triethylsilyloxy)-3,4-dihydro-2H-pyran-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3S,4R)-3,4-bis(triethylsilyloxy)-3,4-dihydro-2H-pyran-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 162414638 |
| Molecular Formula | C24H52O4Si3 |
| Molecular Weight | 488.93 g/mol |
| Exact Mass | 488.32 |
| IUPAC Name | [(3S,4R)-3,4-bis(triethylsilyloxy)-3,4-dihydro-2H-pyran-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C=COC(CO[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C24H52O4Si3/c1-12-30(13-2,14-3)27-21-18-19-25-22(20-26-29(10,11)24(7,8)9)23(21)28-31(15-4,16-5)17-6/h18-19,21-23H,12-17,20H2,1-11H3/t21-,22?,23-/m1/s1 |
| InChIKey | IMJRPULMBSCXOF-OJVMETQDSA-N |
| XLogP | 7.70 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.93 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|