C31H52O5Si — CID 162414989
[(1S)-1-[(1R,4S)-3-[2,6-bis(methoxymethoxy)-4-pentylphenyl]-4-prop-1-en-2-ylcyclopent-2-en-1-yl]ethoxy]-tert-butyl-dimethylsilane (PubChem CID 162414989) has the molecular formula C31H52O5Si and a molecular weight of 532.84 g/mol. Its IUPAC name is [(1S)-1-[(1R,4S)-3-[2,6-bis(methoxymethoxy)-4-pentylphenyl]-4-prop-1-en-2-ylcyclopent-2-en-1-yl]ethoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1S)-1-[(1R,4S)-3-[2,6-bis(methoxymethoxy)-4-pentylphenyl]-4-prop-1-en-2-ylcyclopent-2-en-1-yl]ethoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 162414989 |
| Molecular Formula | C31H52O5Si |
| Molecular Weight | 532.84 g/mol |
| Exact Mass | 532.36 |
| IUPAC Name | [(1S)-1-[(1R,4S)-3-[2,6-bis(methoxymethoxy)-4-pentylphenyl]-4-prop-1-en-2-ylcyclopent-2-en-1-yl]ethoxy]-tert-butyl-dimethylsilane |
| SMILES | C=C(C)[C@@H]1C[C@@H]([C@H](C)O[Si](C)(C)C(C)(C)C)C=C1c1c(OCOC)cc(CCCCC)cc1OCOC |
| InChI | InChI=1S/C31H52O5Si/c1-12-13-14-15-24-16-28(34-20-32-8)30(29(17-24)35-21-33-9)27-19-25(18-26(27)22(2)3)23(4)36-37(10,11)31(5,6)7/h16-17,19,23,25-26H,2,12-15,18,20-21H2,1,3-11H3/t23-,25+,26-/m0/s1 |
| InChIKey | NLLDDTLGQWKRME-DMDYGQEQSA-N |
| XLogP | 8.39 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.84 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|