C15H30O4 — CID 162415101
(E,12S)-8,8-dimethoxytridec-3-ene-2,12-diol (PubChem CID 162415101) has the molecular formula C15H30O4 and a molecular weight of 274.40 g/mol. Its IUPAC name is (E,12S)-8,8-dimethoxytridec-3-ene-2,12-diol.
| Compound Name | (E,12S)-8,8-dimethoxytridec-3-ene-2,12-diol |
|---|---|
| PubChem CID | 162415101 |
| Molecular Formula | C15H30O4 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | (E,12S)-8,8-dimethoxytridec-3-ene-2,12-diol |
| SMILES | COC(CCC/C=C/C(C)O)(CCC[C@H](C)O)OC |
| InChI | InChI=1S/C15H30O4/c1-13(16)9-6-5-7-11-15(18-3,19-4)12-8-10-14(2)17/h6,9,13-14,16-17H,5,7-8,10-12H2,1-4H3/b9-6+/t13?,14-/m0/s1 |
| InChIKey | FSYKMYUFCAOYQO-YKBKNTEJSA-N |
| XLogP | 2.63 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|