C11H4ClF7 — CID 162415144
1-chloro-4-(3,3,4,4,5,5,5-heptafluoropent-1-ynyl)benzene (PubChem CID 162415144) has the molecular formula C11H4ClF7 and a molecular weight of 304.59 g/mol. Its IUPAC name is 1-chloro-4-(3,3,4,4,5,5,5-heptafluoropent-1-ynyl)benzene.
| Compound Name | 1-chloro-4-(3,3,4,4,5,5,5-heptafluoropent-1-ynyl)benzene |
|---|---|
| PubChem CID | 162415144 |
| Molecular Formula | C11H4ClF7 |
| Molecular Weight | 304.59 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 1-chloro-4-(3,3,4,4,5,5,5-heptafluoropent-1-ynyl)benzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C#Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H4ClF7/c12-8-3-1-7(2-4-8)5-6-9(13,14)10(15,16)11(17,18)19/h1-4H |
| InChIKey | HONBSHUMXJJULT-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|