C31H47NO3 — CID 162415146
[(3S,5S,8R,9R,10S,13R,14R,17R)-8-cyano-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-11-oxo-2,3,4,5,6,7,9,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 162415146) has the molecular formula C31H47NO3 and a molecular weight of 481.72 g/mol. Its IUPAC name is [(3S,5S,8R,9R,10S,13R,14R,17R)-8-cyano-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-11-oxo-2,3,4,5,6,7,9,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5S,8R,9R,10S,13R,14R,17R)-8-cyano-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-11-oxo-2,3,4,5,6,7,9,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 162415146 |
| Molecular Formula | C31H47NO3 |
| Molecular Weight | 481.72 g/mol |
| Exact Mass | 481.36 |
| IUPAC Name | [(3S,5S,8R,9R,10S,13R,14R,17R)-8-cyano-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-11-oxo-2,3,4,5,6,7,9,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@@]3(C#N)[C@@H]4CC[C@H]([C@H](C)/C=C/[C@H](C)C(C)C)[C@@]4(C)CC(=O)[C@H]23)C1 |
| InChI | InChI=1S/C31H47NO3/c1-19(2)20(3)8-9-21(4)25-10-11-27-30(25,7)17-26(34)28-29(6)14-13-24(35-22(5)33)16-23(29)12-15-31(27,28)18-32/h8-9,19-21,23-25,27-28H,10-17H2,1-7H3/b9-8+/t20-,21+,23-,24-,25+,27+,28+,29-,30+,31+/m0/s1 |
| InChIKey | JCFHNSHTOXCTIS-HTAQHFHDSA-N |
| XLogP | 7.13 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.72 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|