C14H17F2NO3 — CID 162415233
ethyl (6E)-2,2-difluoro-6-hydroxyimino-6-phenylhexanoate (PubChem CID 162415233) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is ethyl (6E)-2,2-difluoro-6-hydroxyimino-6-phenylhexanoate.
| Compound Name | ethyl (6E)-2,2-difluoro-6-hydroxyimino-6-phenylhexanoate |
|---|---|
| PubChem CID | 162415233 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | ethyl (6E)-2,2-difluoro-6-hydroxyimino-6-phenylhexanoate |
| SMILES | CCOC(=O)C(F)(F)CCC/C(=N\O)c1ccccc1 |
| InChI | InChI=1S/C14H17F2NO3/c1-2-20-13(18)14(15,16)10-6-9-12(17-19)11-7-4-3-5-8-11/h3-5,7-8,19H,2,6,9-10H2,1H3/b17-12+ |
| InChIKey | FLLJVNWUUXSBKQ-SFQUDFHCSA-N |
| XLogP | 3.23 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|