C21H25O8P — CID 162415253
(4aR,6S,7R,8R,8aR)-2-hydroxy-6-methoxy-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxaphosphinine 2-oxide (PubChem CID 162415253) has the molecular formula C21H25O8P and a molecular weight of 436.40 g/mol. Its IUPAC name is (4aR,6S,7R,8R,8aR)-2-hydroxy-6-methoxy-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxaphosphinine 2-oxide.
| Compound Name | (4aR,6S,7R,8R,8aR)-2-hydroxy-6-methoxy-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxaphosphinine 2-oxide |
|---|---|
| PubChem CID | 162415253 |
| Molecular Formula | C21H25O8P |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | (4aR,6S,7R,8R,8aR)-2-hydroxy-6-methoxy-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxaphosphinine 2-oxide |
| SMILES | CO[C@H]1O[C@@H]2COP(=O)(O)O[C@H]2[C@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C21H25O8P/c1-24-21-20(26-13-16-10-6-3-7-11-16)19(25-12-15-8-4-2-5-9-15)18-17(28-21)14-27-30(22,23)29-18/h2-11,17-21H,12-14H2,1H3,(H,22,23)/t17-,18-,19+,20?,21+/m1/s1 |
| InChIKey | WBVCDAYWHKWPKB-BKUVARHGSA-N |
| XLogP | 3.04 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|