C20H30O5Si — CID 162415425
methyl (2R,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-10-oxo-9-oxatricyclo[6.2.2.02,7]dodeca-3,11-diene-1-carboxylate (PubChem CID 162415425) has the molecular formula C20H30O5Si and a molecular weight of 378.54 g/mol. Its IUPAC name is methyl (2R,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-10-oxo-9-oxatricyclo[6.2.2.02,7]dodeca-3,11-diene-1-carboxylate.
| Compound Name | methyl (2R,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-10-oxo-9-oxatricyclo[6.2.2.02,7]dodeca-3,11-diene-1-carboxylate |
|---|---|
| PubChem CID | 162415425 |
| Molecular Formula | C20H30O5Si |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | methyl (2R,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-10-oxo-9-oxatricyclo[6.2.2.02,7]dodeca-3,11-diene-1-carboxylate |
| SMILES | COC(=O)C12C=CC(OC1=O)[C@@H]1[C@H](C)CC(O[Si](C)(C)C(C)(C)C)=C[C@@H]12 |
| InChI | InChI=1S/C20H30O5Si/c1-12-10-13(25-26(6,7)19(2,3)4)11-14-16(12)15-8-9-20(14,17(21)23-5)18(22)24-15/h8-9,11-12,14-16H,10H2,1-7H3/t12-,14+,15?,16-,20?/m1/s1 |
| InChIKey | MMSKBYGRFNSSKQ-ZAYVZEJKSA-N |
| XLogP | 3.82 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|