C12H22O4 — CID 162415506
methyl (E,3S,6R)-3,9-dihydroxy-6-methyldec-7-enoate (PubChem CID 162415506) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is methyl (E,3S,6R)-3,9-dihydroxy-6-methyldec-7-enoate.
| Compound Name | methyl (E,3S,6R)-3,9-dihydroxy-6-methyldec-7-enoate |
|---|---|
| PubChem CID | 162415506 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | methyl (E,3S,6R)-3,9-dihydroxy-6-methyldec-7-enoate |
| SMILES | COC(=O)C[C@@H](O)CC[C@@H](C)/C=C/C(C)O |
| InChI | InChI=1S/C12H22O4/c1-9(4-6-10(2)13)5-7-11(14)8-12(15)16-3/h4,6,9-11,13-14H,5,7-8H2,1-3H3/b6-4+/t9-,10?,11-/m0/s1 |
| InChIKey | YGAPGWMQOVFRBL-PCMWLWKDSA-N |
| XLogP | 1.26 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|