C23H27NO4 — CID 162415591
ethyl 4-acetamido-2,2-dimethyl-5-oxo-5-(4-phenylphenyl)pentanoate (PubChem CID 162415591) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is ethyl 4-acetamido-2,2-dimethyl-5-oxo-5-(4-phenylphenyl)pentanoate.
| Compound Name | ethyl 4-acetamido-2,2-dimethyl-5-oxo-5-(4-phenylphenyl)pentanoate |
|---|---|
| PubChem CID | 162415591 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | ethyl 4-acetamido-2,2-dimethyl-5-oxo-5-(4-phenylphenyl)pentanoate |
| SMILES | CCOC(=O)C(C)(C)CC(NC(C)=O)C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H27NO4/c1-5-28-22(27)23(3,4)15-20(24-16(2)25)21(26)19-13-11-18(12-14-19)17-9-7-6-8-10-17/h6-14,20H,5,15H2,1-4H3,(H,24,25) |
| InChIKey | NSIBXKWMRWAJNA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |