C13H19NO3 — CID 162415713
(3aR,5S,5aS,7R,7aR,7bS)-7-(hydroxymethyl)-2,5-dimethyl-3a,4,5,5a,6,7,7a,7b-octahydrocyclobuta[e]isoindole-1,3-dione (PubChem CID 162415713) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is (3aR,5S,5aS,7R,7aR,7bS)-7-(hydroxymethyl)-2,5-dimethyl-3a,4,5,5a,6,7,7a,7b-octahydrocyclobuta[e]isoindole-1,3-dione.
| Compound Name | (3aR,5S,5aS,7R,7aR,7bS)-7-(hydroxymethyl)-2,5-dimethyl-3a,4,5,5a,6,7,7a,7b-octahydrocyclobuta[e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 162415713 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | (3aR,5S,5aS,7R,7aR,7bS)-7-(hydroxymethyl)-2,5-dimethyl-3a,4,5,5a,6,7,7a,7b-octahydrocyclobuta[e]isoindole-1,3-dione |
| SMILES | C[C@H]1C[C@H]2C(=O)N(C)C(=O)[C@H]2[C@H]2[C@H](CO)C[C@H]21 |
| InChI | InChI=1S/C13H19NO3/c1-6-3-9-11(13(17)14(2)12(9)16)10-7(5-15)4-8(6)10/h6-11,15H,3-5H2,1-2H3/t6-,7-,8-,9+,10-,11+/m0/s1 |
| InChIKey | FSYNNUVISXJRBK-XSOQRLTHSA-N |
| XLogP | 0.50 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|