C33H36N2O+2 — CID 162416014
(S)-(1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl)-(1-benzylquinolin-1-ium-4-yl)methanol (PubChem CID 162416014) has the molecular formula C33H36N2O+2 and a molecular weight of 476.66 g/mol. Its IUPAC name is (S)-(1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl)-(1-benzylquinolin-1-ium-4-yl)methanol.
| Compound Name | (S)-(1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl)-(1-benzylquinolin-1-ium-4-yl)methanol |
|---|---|
| PubChem CID | 162416014 |
| Molecular Formula | C33H36N2O+2 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | (S)-(1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl)-(1-benzylquinolin-1-ium-4-yl)methanol |
| SMILES | C=CC1C[N+]2(Cc3ccccc3)CCC1CC2[C@@H](O)c1cc[n+](Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C33H36N2O/c1-2-27-24-35(23-26-13-7-4-8-14-26)20-18-28(27)21-32(35)33(36)30-17-19-34(22-25-11-5-3-6-12-25)31-16-10-9-15-29(30)31/h2-17,19,27-28,32-33,36H,1,18,20-24H2/q+2/t27?,28?,32?,33-,35?/m0/s1 |
| InChIKey | ZKPLXTFEOCJTDF-NEVXMMAWSA-N |
| XLogP | 5.82 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|