C12H15NO5 — CID 162416061
dimethyl (2R,4R,5S)-5-(furan-2-yl)pyrrolidine-2,4-dicarboxylate (PubChem CID 162416061) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is dimethyl (2R,4R,5S)-5-(furan-2-yl)pyrrolidine-2,4-dicarboxylate.
| Compound Name | dimethyl (2R,4R,5S)-5-(furan-2-yl)pyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 162416061 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | dimethyl (2R,4R,5S)-5-(furan-2-yl)pyrrolidine-2,4-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H](C(=O)OC)[C@@H](c2ccco2)N1 |
| InChI | InChI=1S/C12H15NO5/c1-16-11(14)7-6-8(12(15)17-2)13-10(7)9-4-3-5-18-9/h3-5,7-8,10,13H,6H2,1-2H3/t7-,8-,10+/m1/s1 |
| InChIKey | JKROPFFCSWRSBH-MRTMQBJTSA-N |
| XLogP | 0.64 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |